cas: 13080-85-8 — see every product listed under this CAS number, including other names
4,4-Bis(4-aminophenoxy)biphenyl, 98%, 98% (CAS 13080-85-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UYX-5g |
| cas | 13080-85-8 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 275.60 Pln | |
| Chemat | 500g | 1003.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline (CAS 13080-85-8) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline. InChIKey: HYDATEKARGDBKU-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline |
| InChIKey | HYDATEKARGDBKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)OC3=CC=C(C=C3)N)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)