cas: 604785-54-8 — see every product listed under this CAS number, including other names
4,4'-Bis(9H-carbazol-9-yl)-2,2'-dimethylbiphenyl, >98.0%(HPLC)(N) (CAS 604785-54-8) is a chemical reagent available from Chemat. Available pack sizes: 200mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4910-200MG |
| cas | 604785-54-8 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 600.24 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole (CAS 604785-54-8) is a chemical compound with the molecular formula C38H28N2 and a molecular weight of 512.6 g/mol. IUPAC name: 9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole. InChIKey: LTUJKAYZIMMJEP-UHFFFAOYSA-N.
| Molecular formula | C38H28N2 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | 9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole |
| InChIKey | LTUJKAYZIMMJEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C3=CC=CC=C3C4=CC=CC=C42)C5=C(C=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86)C |
Computed by PubChem (NCBI)