cas: 604785-54-8 — see every product listed under this CAS number, including other names
9,9'-(2,2'-Dimethyl-[1,1'-biphenyl]-4,4'-diyl)bis(9H-carbazole) (CAS 604785-54-8) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJS7-200mg |
| cas | 604785-54-8 |
| size | 200mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 611.60 Pln | |
| Chemat | 50mg | 328.40 Pln |
| delivery time | 3 weeks |
|---|
9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole (CAS 604785-54-8) is a chemical compound with the molecular formula C38H28N2 and a molecular weight of 512.6 g/mol. IUPAC name: 9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole. InChIKey: LTUJKAYZIMMJEP-UHFFFAOYSA-N.
| Molecular formula | C38H28N2 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | 9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole |
| InChIKey | LTUJKAYZIMMJEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C3=CC=CC=C3C4=CC=CC=C42)C5=C(C=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86)C |
Computed by PubChem (NCBI)