CAS 1820649-33-9 is the registry number for 5,5'-Difluoro-3,3'-bipyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-fluoro-5-(5-fluoro-3-pyridinyl)pyridine (CAS 1820649-33-9) is a chemical compound with the molecular formula C10H6F2N2 and a molecular weight of 192.16 g/mol. IUPAC name: 3-fluoro-5-(5-fluoro-3-pyridinyl)pyridine. InChIKey: HYELTGIFBABGRJ-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2 |
|---|---|
| Molecular weight | 192.16 g/mol |
| IUPAC name | 3-fluoro-5-(5-fluoro-3-pyridinyl)pyridine |
| InChIKey | HYELTGIFBABGRJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1F)C2=CC(=CN=C2)F |
Computed by PubChem (NCBI)