CAS 959236-20-5 appears in our catalog under these names: 2-(5,6-Difluoro-1H-indol-3-yl)acetonitrile, 95%, 2-(5,6-Difluoro-1H-indol-3-yl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(5,6-difluoro-1H-indol-3-yl)acetonitrile (CAS 959236-20-5) is a chemical compound with the molecular formula C10H6F2N2 and a molecular weight of 192.16 g/mol. IUPAC name: 2-(5,6-difluoro-1H-indol-3-yl)acetonitrile. InChIKey: DAYKAFDVIDUDPN-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2 |
|---|---|
| Molecular weight | 192.16 g/mol |
| IUPAC name | 2-(5,6-difluoro-1H-indol-3-yl)acetonitrile |
| InChIKey | DAYKAFDVIDUDPN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC=C2CC#N |
Computed by PubChem (NCBI)