CAS 1041837-79-9 appears in our catalog under these names: 5,5'-Difluoro-2,2'-bipyridine, 98%, 98%, 5,5'-Difluoro-2,2'-bipyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-fluoro-2-(5-fluoro-2-pyridinyl)pyridine (CAS 1041837-79-9) is a chemical compound with the molecular formula C10H6F2N2 and a molecular weight of 192.16 g/mol. IUPAC name: 5-fluoro-2-(5-fluoro-2-pyridinyl)pyridine. InChIKey: QGMACLFYKMYCNI-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2 |
|---|---|
| Molecular weight | 192.16 g/mol |
| IUPAC name | 5-fluoro-2-(5-fluoro-2-pyridinyl)pyridine |
| InChIKey | QGMACLFYKMYCNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1F)C2=NC=C(C=C2)F |
Computed by PubChem (NCBI)