CAS 53197-57-2 appears in our catalog under these names: 4,4'-Dihydroxy-biphenyl-2-carboxylic acid, 4,4'-Dihydroxy-[1,1'-biphenyl]-2-carboxylic acid, 97%, 4,4'-Dihydroxy-[1,1'-biphenyl]-2-carboxylic acid, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-hydroxy-2-(4-hydroxyphenyl)benzoic acid (CAS 53197-57-2) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxyphenyl)benzoic acid. InChIKey: BBGRLYLKUDNCGG-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxyphenyl)benzoic acid |
| InChIKey | BBGRLYLKUDNCGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)O)C(=O)O)O |
Computed by PubChem (NCBI)