Products 17295-26-0
CAS 17295-26-0 appears in our catalog under these names: 6-Acetoxy-2-naphthoic acid, 95%, 6–Acetoxy–2–naphthoic Acid, 6-Acetoxy-2-naphthoic Acid, >98.0%(HPLC)(T), 6-Acetoxy-2-naphthoic Acid, 98%, 98%, 6-(Acetyloxy)-2-naphthoic acid, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 200mg, 25g.
6-acetyloxynaphthalene-2-carboxylic acid (CAS 17295-26-0) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 6-acetyloxynaphthalene-2-carboxylic acid. InChIKey: NFTLBCXRDNIJMI-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 6-acetyloxynaphthalene-2-carboxylic acid |
| InChIKey | NFTLBCXRDNIJMI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-Acetoxy-2-naphthoic Acid, 6-Hydroxy-2-naphthoic acid acetate, 2-Naphthalenecarboxylic acid, 6-(acetyloxy)-, 6-(Acetyloxy)-2-naphthalenecarboxylic acid, 6-(Acetyloxy)-2-naphthoic acid, 6-acetyloxynaphthalene-2-carboxylic acid, 6-(acetyloxy)naphthalene-2-carboxylic acid, 6-acetoxynaphthalene-2-carboxylic acid, 2-acetoxy-6-naphthoic acid, 6-acetyloxy-2-naphthoic acid