CAS 1470-79-7 appears in our catalog under these names: 2,4,4'-Trihydroxybenzophenone, 95%, 2,4,4'–Trihydroxybenzophenone, 2,4,4'-Trihydroxybenzophenone, >98.0%(HPLC)(T), 2,4,4-Trihydroxybenzophenone, 98%, 98%, (2,4-Dihydroxyphenyl)(4-hydroxyphenyl)methanone, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 250mg, 100mg.
(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone (CAS 1470-79-7) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: OKJFKPFBSPZTAH-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | OKJFKPFBSPZTAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)O)O)O |
Computed by PubChem (NCBI)