CAS 52938-95-1 appears in our catalog under these names: 5-(4-Acetylphenyl)furan-2-carboxylic acid, 95%, 95%, 5-(4-Acetylphenyl)-2-furoic acid, 95%, 5-(4-Acetylphenyl)furan-2-carboxylic acid, 95%. Offered by: Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
5-(4-acetylphenyl)furan-2-carboxylic acid (CAS 52938-95-1) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 5-(4-acetylphenyl)furan-2-carboxylic acid. InChIKey: LDTWCUABWGGMNW-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 5-(4-acetylphenyl)furan-2-carboxylic acid |
| InChIKey | LDTWCUABWGGMNW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)