4,4'-Diiodo-2,2'-dimethyl-1,1'-biphenyl, 95%
cas: 69571-02-4 — see every product listed under this CAS number, including other names
4,4'-Diiodo-2,2'-dimethyl-1,1'-biphenyl, 95% (CAS 69571-02-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A808261-250mg |
| cas | 69571-02-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 503.88 Pln | |
| Ambeed | 25g | 1149.12 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 386.56 Pln | |
| BLDpharm | 10g | 536.50 Pln | |
| BLDpharm | 25g | 1236.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene (CAS 69571-02-4) is a chemical compound with the molecular formula C14H12I2 and a molecular weight of 434.05 g/mol. IUPAC name: 4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene. InChIKey: WHFMNDMHTIOIMS-UHFFFAOYSA-N.
| Molecular formula | C14H12I2 |
|---|---|
| Molecular weight | 434.05 g/mol |
| IUPAC name | 4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene |
| InChIKey | WHFMNDMHTIOIMS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)I)C2=C(C=C(C=C2)I)C |
Computed by PubChem (NCBI)