CAS 7583-27-9 appears in our catalog under these names: 4,4'-Diiodo-3,3'-dimethylbiphenyl, 98%, 4,4'-Diiodo-3,3'-dimethylbiphenyl, >98.0%(GC), 4,4'-Diiodo-3,3'-dimethylbiphenyl, 98%, 98%, 4,4'-DIIODO-3,3'-DIMETHYLBIPHENYL, 98%+(GC-MS),RG. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
1-iodo-4-(4-iodo-3-methylphenyl)-2-methylbenzene (CAS 7583-27-9) is a chemical compound with the molecular formula C14H12I2 and a molecular weight of 434.05 g/mol. IUPAC name: 1-iodo-4-(4-iodo-3-methylphenyl)-2-methylbenzene. InChIKey: ISWXEMYZGWXIIZ-UHFFFAOYSA-N.
| Molecular formula | C14H12I2 |
|---|---|
| Molecular weight | 434.05 g/mol |
| IUPAC name | 1-iodo-4-(4-iodo-3-methylphenyl)-2-methylbenzene |
| InChIKey | ISWXEMYZGWXIIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)I)C)I |
Computed by PubChem (NCBI)