CAS 144180-63-2 appears in our catalog under these names: 2,2'-Diiodo-6,6'-dimethylbiphenyl, 95%, 2,2'-Diiodo-6,6'-dimethylbiphenyl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 45g.
1-iodo-2-(2-iodo-6-methylphenyl)-3-methylbenzene (CAS 144180-63-2) is a chemical compound with the molecular formula C14H12I2 and a molecular weight of 434.05 g/mol. IUPAC name: 1-iodo-2-(2-iodo-6-methylphenyl)-3-methylbenzene. InChIKey: UKZXGBNQRZGWQM-UHFFFAOYSA-N.
| Molecular formula | C14H12I2 |
|---|---|
| Molecular weight | 434.05 g/mol |
| IUPAC name | 1-iodo-2-(2-iodo-6-methylphenyl)-3-methylbenzene |
| InChIKey | UKZXGBNQRZGWQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)I)C2=C(C=CC=C2I)C |
Computed by PubChem (NCBI)