CAS 69571-02-4 appears in our catalog under these names: 4,4'–Diiodo–2,2'–dimethylbiphenyl, 4,4'-Diiodo-2,2'-dimethylbiphenyl, >98.0%(GC), 4,4'-Diiodo-2,2'-dimethyl-1,1'-biphenyl 95%, 4,4'-Diiodo-2,2'-dimethyl-1,1'-biphenyl, 97%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene (CAS 69571-02-4) is a chemical compound with the molecular formula C14H12I2 and a molecular weight of 434.05 g/mol. IUPAC name: 4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene. InChIKey: WHFMNDMHTIOIMS-UHFFFAOYSA-N.
| Molecular formula | C14H12I2 |
|---|---|
| Molecular weight | 434.05 g/mol |
| IUPAC name | 4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene |
| InChIKey | WHFMNDMHTIOIMS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)I)C2=C(C=C(C=C2)I)C |
Computed by PubChem (NCBI)