Products 90-96-0
CAS 90-96-0 appears in our catalog under these names: 4,4'-Dimethoxybenzophenone, >95% (HPLC), 4,4’–Dimethoxybenzophenone, 4,4'-Dimethoxybenzophenone, 98+% , 4,4'-Dimethoxybenzophenone, 4,4'-Dimethoxybenzophenone, >99.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 2,5g, 5g, 100g, 500g, 25g, 1kg, 0,5kg.
Bis(4-methoxyphenyl)methanone (CAS 90-96-0) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: bis(4-methoxyphenyl)methanone. InChIKey: RFVHVYKVRGKLNK-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | bis(4-methoxyphenyl)methanone |
| InChIKey | RFVHVYKVRGKLNK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)