cas: 15191-69-2 — see every product listed under this CAS number, including other names
4,4,4-Trifluoro-1-(2-methoxy-phenyl)-butane-1,3-dione, 97% (CAS 15191-69-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F026136-50MG |
| cas | 15191-69-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 310.33 Pln | |
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 500mg | 893.45 Pln | |
| Fluorochem | 1g | 1190.22 Pln | |
| Fluorochem | 2.5g | 2320.03 Pln | |
| Fluorochem | 5g | 3689.34 Pln | |
| Fluorochem | 10g | 5600.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,4,4-trifluoro-1-(2-methoxyphenyl)butane-1,3-dione (CAS 15191-69-2) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: 4,4,4-trifluoro-1-(2-methoxyphenyl)butane-1,3-dione. InChIKey: MEKQEULAECFIOH-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(2-methoxyphenyl)butane-1,3-dione |
| InChIKey | MEKQEULAECFIOH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)