CAS 898787-11-6 appears in our catalog under these names: 3'-Carboethoxy-2,2,2-trifluoroacetophenone, 95%, Ethyl 3-(2,2,2-trifluoroacetyl)benzoate, 97+%, Ethyl 3–(2,2,2–Trifluoroacetyl)benzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g.
Ethyl 3-(2,2,2-trifluoroacetyl)benzoate (CAS 898787-11-6) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: ethyl 3-(2,2,2-trifluoroacetyl)benzoate. InChIKey: DIDNWEUOZHFCKH-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | ethyl 3-(2,2,2-trifluoroacetyl)benzoate |
| InChIKey | DIDNWEUOZHFCKH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC(=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)