Products 898787-14-9
CAS 898787-14-9 appears in our catalog under these names: 4'-Carboethoxy-2,2,2-trifluoroacetophenone, 95%, Ethyl 4–(2，2，2–Trifluoroacetyl)benzoate, Ethyl 4-(2,2,2-Trifluoroacetyl)benzoate 98%, Ethyl 4-(2,2,2-Trifluoroacetyl)benzoate, 98%, 98%, 4'-Carboethoxy-2,2,2-trifluoroacetophenone, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Ethyl 4-(2,2,2-trifluoroacetyl)benzoate (CAS 898787-14-9) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: ethyl 4-(2,2,2-trifluoroacetyl)benzoate. InChIKey: MSPQBVVINOKAFC-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | ethyl 4-(2,2,2-trifluoroacetyl)benzoate |
| InChIKey | MSPQBVVINOKAFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)