Products 1092460-71-3
CAS 1092460-71-3 appears in our catalog under these names: 3-Methoxy-5-(trifluoromethyl)cinnamic acid, 95%, 3-Methoxy-5-(trifluoromethyl)cinnamic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(E)-3-[3-methoxy-5-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 1092460-71-3) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: (E)-3-[3-methoxy-5-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: PHVYEXUYVALSAZ-NSCUHMNNSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | (E)-3-[3-methoxy-5-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | PHVYEXUYVALSAZ-NSCUHMNNSA-N |
| SMILES | COC1=CC(=CC(=C1)C(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)