cas: 57965-21-6 — see every product listed under this CAS number, including other names
4,4,4-Trifluoro-1-(3-methoxyphenyl)butane-1,3-dione, 95%, 95% (CAS 57965-21-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 15g, 25g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EA6B-5g |
| cas | 57965-21-6 |
| size | 5g |
| availability | 75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 486.80 Pln | |
| Chemat | 10g | 894.80 Pln | |
| Chemat | 15g | 1274.00 Pln | |
| Chemat | 25g | 1763.60 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 170.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,4,4-trifluoro-1-(3-methoxyphenyl)butane-1,3-dione (CAS 57965-21-6) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: 4,4,4-trifluoro-1-(3-methoxyphenyl)butane-1,3-dione. InChIKey: DIZYLXQPKFYSGQ-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(3-methoxyphenyl)butane-1,3-dione |
| InChIKey | DIZYLXQPKFYSGQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)