Products 57965-21-6
CAS 57965-21-6 appears in our catalog under these names: 4，4，4–Trifluoro–1–(3–methoxyphenyl)butane–1，3–dione, 4,4,4-Trifluoro-1-(3-methoxyphenyl)butane-1,3-dione, 95%, 95%, 4,4,4-Trifluoro-1-(3-methoxy-phenyl)-butane-1,3-dione, 97%, 4,4,4-Trifluoro-1-(3-methoxyphenyl)butane-1,3-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 100mg, 250mg.
4,4,4-trifluoro-1-(3-methoxyphenyl)butane-1,3-dione (CAS 57965-21-6) is a chemical compound with the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. IUPAC name: 4,4,4-trifluoro-1-(3-methoxyphenyl)butane-1,3-dione. InChIKey: DIZYLXQPKFYSGQ-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O3 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(3-methoxyphenyl)butane-1,3-dione |
| InChIKey | DIZYLXQPKFYSGQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)