CAS 269410-04-0 appears in our catalog under these names: 2,4,6-Trimethoxyphenylboronic acid, pinacol ester, 95%, 4,4,5,5-Tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane, 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g.
4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane (CAS 269410-04-0) is a chemical compound with the molecular formula C15H23BO5 and a molecular weight of 294.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane. InChIKey: LKEZAAIPHZMQDT-UHFFFAOYSA-N.
| Molecular formula | C15H23BO5 |
|---|---|
| Molecular weight | 294.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | LKEZAAIPHZMQDT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2OC)OC)OC |
Computed by PubChem (NCBI)