cas: 942069-95-6 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane 96% (CAS 942069-95-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270434-250mg |
| cas | 942069-95-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1327.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A270434 |
4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane (CAS 942069-95-6) is a chemical compound with the molecular formula C12H14BCl3O2 and a molecular weight of 307.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane. InChIKey: OTPVENHYVDCFAO-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl3O2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane |
| InChIKey | OTPVENHYVDCFAO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)