cas: 942069-95-6 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane, 96%, 96% (CAS 942069-95-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KDA-250mg |
| cas | 942069-95-6 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 25g | 688.40 Pln | |
| Chemat | 100g | 2565.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane (CAS 942069-95-6) is a chemical compound with the molecular formula C12H14BCl3O2 and a molecular weight of 307.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane. InChIKey: OTPVENHYVDCFAO-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl3O2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane |
| InChIKey | OTPVENHYVDCFAO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)