4,4,5,5-Tetramethyl-2-(4-((tetrahydro-2H-pyran-2-yl)methoxy)phenyl)-1,3,2-dioxaborolane, 95%
cas: 2246378-88-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-((tetrahydro-2H-pyran-2-yl)methoxy)phenyl)-1,3,2-dioxaborolane, 95% (CAS 2246378-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1530557-100mg |
| cas | 2246378-88-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 3123.81 Pln | |
| Ambeed | 25g | 10694.38 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 1g | 837.20 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 408.77 Pln | |
| BLDpharm | 1g | 919.70 Pln | |
| BLDpharm | 5g | 3063.39 Pln | |
| BLDpharm | 25g | 10483.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-[4-(oxan-2-ylmethoxy)phenyl]-1,3,2-dioxaborolane (CAS 2246378-88-9) is a chemical compound with the molecular formula C18H27BO4 and a molecular weight of 318.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(oxan-2-ylmethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: IPXRPRMFCGDANY-UHFFFAOYSA-N.
| Molecular formula | C18H27BO4 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(oxan-2-ylmethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | IPXRPRMFCGDANY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3CCCCO3 |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5-Tetramethyl-2-[4-(oxan-2-ylmethoxy)phenyl]-1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-{4-[(oxan-2-yl)methoxy]phenyl}-1,3,2-dioxaborolane, 4-[(Tetrahydro-2H-pyran-2-yl)methoxy]phenylboronic Acid Pinacol Ester, Tetrahydro-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]...