CAS 1917297-41-6 is the registry number for Methyl 2,2-dimethyl-3-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Methyl 2,2-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (CAS 1917297-41-6) is a chemical compound with the molecular formula C18H27BO4 and a molecular weight of 318.2 g/mol. IUPAC name: methyl 2,2-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate. InChIKey: BRYWJRZGMSVJQL-UHFFFAOYSA-N.
| Molecular formula | C18H27BO4 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | methyl 2,2-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| InChIKey | BRYWJRZGMSVJQL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC(C)(C)C(=O)OC |
Computed by PubChem (NCBI)