CAS 1073493-92-1 appears in our catalog under these names: 4-(t-Butoxycarbonyl)-2-methylphenylboronic acid, pinacol ester, 97%, tert-Butyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%, 4-(t-Butoxycarbonyl)-2-methylphenylboronic acid, pinacol ester, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
Tert-butyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1073493-92-1) is a chemical compound with the molecular formula C18H27BO4 and a molecular weight of 318.2 g/mol. IUPAC name: tert-butyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: OZXRFFSWFUALSU-UHFFFAOYSA-N.
| Molecular formula | C18H27BO4 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | tert-butyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | OZXRFFSWFUALSU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)