CAS 1282659-60-2 is the registry number for 2-(4-(4,4,5,5-Tetramethyl-(1,3,2)dioxaborolan-2-yl)phenyl)butyric Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate (CAS 1282659-60-2) is a chemical compound with the molecular formula C18H27BO4 and a molecular weight of 318.2 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate. InChIKey: AEPIHPYIIHLBHG-UHFFFAOYSA-N.
| Molecular formula | C18H27BO4 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoate |
| InChIKey | AEPIHPYIIHLBHG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(CC)C(=O)OCC |
Computed by PubChem (NCBI)