cas: 157735-10-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(pent-4-en-1-yl)-1,3,2-dioxaborolane 97% +(stabilized with TBC) (CAS 157735-10-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A985696-250mg |
| cas | 157735-10-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1510.69 Pln |
| purity | 97% +(stabilized with TBC) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A985696 |
4,4,5,5-tetramethyl-2-pent-4-enyl-1,3,2-dioxaborolane (CAS 157735-10-9) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pent-4-enyl-1,3,2-dioxaborolane. InChIKey: MDJWICJDSRJONO-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pent-4-enyl-1,3,2-dioxaborolane |
| InChIKey | MDJWICJDSRJONO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCC=C |
Computed by PubChem (NCBI)