CAS 157735-10-9 appears in our catalog under these names: 4-Pentenylboronic acid pinacol ester, 97%, 4,4,5,5-Tetramethyl-2-(pent-4-en-1-yl)-1,3,2-dioxaborolane 97% +(stabilized with TBC), 4,4,5,5-Tetramethyl-2-(pent-4-en-1-yl)-1,3,2-dioxaborolane, 97%, 97%, 4,4,5,5-Tetramethyl-2-(pent-4-en-1-yl)-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.
4,4,5,5-tetramethyl-2-pent-4-enyl-1,3,2-dioxaborolane (CAS 157735-10-9) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pent-4-enyl-1,3,2-dioxaborolane. InChIKey: MDJWICJDSRJONO-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pent-4-enyl-1,3,2-dioxaborolane |
| InChIKey | MDJWICJDSRJONO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCC=C |
Computed by PubChem (NCBI)