CAS 141550-13-2 appears in our catalog under these names: 2–(3–Methyl–but–2–enyl)–4,4,5,5–tetraMethyl–1,3,2–dioxaborolane, 4,4,5,5-Tetramethyl-2-(3-methylbut-2-en-1-yl)-1,3,2-dioxaborolane, 95%, 3-METHYL-2-BUTENYLBORONIC ACID PINACOL &, 3-Methylbut-2-enylboronic acid, pinacol ester, 97%. Offered by: GLPBio, Fluorochem, Sigma-Aldrich, Combi-blocks. Available pack sizes: 1g, 500mg, 250mg, 5g, 10g, 25g.
4,4,5,5-tetramethyl-2-(3-methylbut-2-enyl)-1,3,2-dioxaborolane (CAS 141550-13-2) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylbut-2-enyl)-1,3,2-dioxaborolane. InChIKey: QXDMQRNIDKVRCN-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylbut-2-enyl)-1,3,2-dioxaborolane |
| InChIKey | QXDMQRNIDKVRCN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC=C(C)C |
Computed by PubChem (NCBI)