CAS 66217-55-8 appears in our catalog under these names: 2-Cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2–cyclopentyl–4,4,5,5–tetraMethyl–1,3,2–dioxaborolane, 2-Cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95.0%(GC)(T), 2-Cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, Cyclopentylboronic acid pinacol ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100g.
2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 66217-55-8) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BLLUYOVVBCMKHV-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BLLUYOVVBCMKHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCC2 |
Computed by PubChem (NCBI)