cas: 10466-37-2 — see every product listed under this CAS number, including other names
4,4′-Methylenebis[benzonitrile], 95%, 95% (CAS 10466-37-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119R8Z-250mg |
| cas | 10466-37-2 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 10g | 654.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[(4-cyanophenyl)methyl]benzonitrile (CAS 10466-37-2) is a chemical compound with the molecular formula C15H10N2 and a molecular weight of 218.25 g/mol. IUPAC name: 4-[(4-cyanophenyl)methyl]benzonitrile. InChIKey: QHPFUQAZWHBITN-UHFFFAOYSA-N.
| Molecular formula | C15H10N2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 4-[(4-cyanophenyl)methyl]benzonitrile |
| InChIKey | QHPFUQAZWHBITN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)