CAS 10466-37-2 appears in our catalog under these names: 4,4'-(1-Methylene) bis-benzonitrile, 95%, 4,4'-(1-Methylene) bis-Benzonitrile, >95% (HPLC), 4,4'-Methylenedibenzonitrile, 4,4'-(1-Methylene)bis-benzonitrile, 4,4'-Methylenedibenzonitrile 95%. Offered by: Combi-blocks, TRC, Mikromol, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 10mg, 50mg, 25mg, 500mg, 1000mg.
4-[(4-cyanophenyl)methyl]benzonitrile (CAS 10466-37-2) is a chemical compound with the molecular formula C15H10N2 and a molecular weight of 218.25 g/mol. IUPAC name: 4-[(4-cyanophenyl)methyl]benzonitrile. InChIKey: QHPFUQAZWHBITN-UHFFFAOYSA-N.
| Molecular formula | C15H10N2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 4-[(4-cyanophenyl)methyl]benzonitrile |
| InChIKey | QHPFUQAZWHBITN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)