CAS 25699-92-7 is the registry number for 4-(1H-Indol-1-yl)benzonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
4-indol-1-ylbenzonitrile (CAS 25699-92-7) is a chemical compound with the molecular formula C15H10N2 and a molecular weight of 218.25 g/mol. IUPAC name: 4-indol-1-ylbenzonitrile. InChIKey: RBIUGBUMKLMULN-UHFFFAOYSA-N.
| Molecular formula | C15H10N2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 4-indol-1-ylbenzonitrile |
| InChIKey | RBIUGBUMKLMULN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)