CAS 80012-69-7 appears in our catalog under these names: Epinastine Impurity 12, Epinastine Impurity 41, 11H-Dibenzo(b,e)azepine-6-carbonitrile. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg.
11H-benzo[c][1]benzazepine-6-carbonitrile (CAS 80012-69-7) is a chemical compound with the molecular formula C15H10N2 and a molecular weight of 218.25 g/mol. IUPAC name: 11H-benzo[c][1]benzazepine-6-carbonitrile. InChIKey: ABWGCWCVNGSQQM-UHFFFAOYSA-N.
| Molecular formula | C15H10N2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 11H-benzo[c][1]benzazepine-6-carbonitrile |
| InChIKey | ABWGCWCVNGSQQM-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=NC3=CC=CC=C31)C#N |
Computed by PubChem (NCBI)