CAS 20440-95-3 appears in our catalog under these names: 4,4'–Dimethyltriphenylamine, 4,4'-Dimethyltriphenylamine, >98.0%(GC), 4,4-Dimethyltriphenylamine, 98%, 98%, 4,4'-Dimethyltriphenylamine, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 5g, 25g.
4-methyl-N-(4-methylphenyl)-N-phenylaniline (CAS 20440-95-3) is a chemical compound with the molecular formula C20H19N and a molecular weight of 273.4 g/mol. IUPAC name: 4-methyl-N-(4-methylphenyl)-N-phenylaniline. InChIKey: YWKKLBATUCJUHI-UHFFFAOYSA-N.
| Molecular formula | C20H19N |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 4-methyl-N-(4-methylphenyl)-N-phenylaniline |
| InChIKey | YWKKLBATUCJUHI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)