4,4-Methylenebis(2,6-dimethylaniline), 97%
cas: 4073-98-7 — see every product listed under this CAS number, including other names
4,4-Methylenebis(2,6-dimethylaniline), 97% (CAS 4073-98-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A252768-5g |
| cas | 4073-98-7 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1260.38 Pln | |
| Ambeed | 500g | 4831.50 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 25g | 442.09 Pln | |
| BLDpharm | 100g | 1352.88 Pln | |
| BLDpharm | 500g | 5207.08 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1557.20 Pln | |
| Chemat | 500g | 6105.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline (CAS 4073-98-7) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline. InChIKey: OMHOXRVODFQGCA-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline |
| InChIKey | OMHOXRVODFQGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)CC2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)
Synonyms:
4,4'-Methylenebis(2,6-dimethylaniline), 4,4'-Methylenebis(2,6-xylidine), Benzenamine, 4,4'-methylenebis(2,6-dimethyl-, Benzenamine, 4,4'-methylenebis[2,6-dimethyl-, bis(4-amino-3,5-dimethylphenyl)methane, 3,3',5,5'-tetramethyl-4,4'-diaminodiphenylmethane, 4-(4-Amino-3,5-dimethylbenzyl)-2,6-dimethylaniline, 4,4-methylenebis(2,6-dimethylaniline), 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline, MBDA-Form-I
