cas: 4073-98-7 — see every product listed under this CAS number, including other names
4,4'-Methylenebis(2,6-dimethylaniline), >98.0%(HPLC)(T) (CAS 4073-98-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3403-5G |
| cas | 4073-98-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 414.87 Pln | |
| TCI | 25g | 1177.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline (CAS 4073-98-7) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline. InChIKey: OMHOXRVODFQGCA-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline |
| InChIKey | OMHOXRVODFQGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)CC2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)