cas: 2164-84-3 — see every product listed under this CAS number, including other names
4,6-Diamino-5-Nitropyrimidine, 95%, 95% (CAS 2164-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCKU-250mg |
| cas | 2164-84-3 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 381.20 Pln | |
| Chemat | 25g | 760.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-nitropyrimidine-4,6-diamine (CAS 2164-84-3) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 5-nitropyrimidine-4,6-diamine. InChIKey: KUCFBGFPXUXWBQ-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 5-nitropyrimidine-4,6-diamine |
| InChIKey | KUCFBGFPXUXWBQ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)