cas: 2164-84-3 — see every product listed under this CAS number, including other names
4,6-Diamino-5-nitropyrimidine 95% (CAS 2164-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165810-250mg |
| cas | 2164-84-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 948.88 Pln | |
| Ambeed | 100g | 2890.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A165810 |
5-nitropyrimidine-4,6-diamine (CAS 2164-84-3) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 5-nitropyrimidine-4,6-diamine. InChIKey: KUCFBGFPXUXWBQ-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 5-nitropyrimidine-4,6-diamine |
| InChIKey | KUCFBGFPXUXWBQ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)