cas: 2164-84-3 — see every product listed under this CAS number, including other names
4,6-Diamino-5-nitropyrimidine, 97% (CAS 2164-84-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077232-5G |
| cas | 2164-84-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 10g | 497.76 Pln | |
| Fluorochem | 25g | 903.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-nitropyrimidine-4,6-diamine (CAS 2164-84-3) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 5-nitropyrimidine-4,6-diamine. InChIKey: KUCFBGFPXUXWBQ-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 5-nitropyrimidine-4,6-diamine |
| InChIKey | KUCFBGFPXUXWBQ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)