CAS 773793-51-4 is the registry number for 4-Nitro-1H-pyrazole-1-carboximidamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-nitropyrazole-1-carboximidamide (CAS 773793-51-4) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 4-nitropyrazole-1-carboximidamide. InChIKey: GWMAVQBKDIWTPH-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 4-nitropyrazole-1-carboximidamide |
| InChIKey | GWMAVQBKDIWTPH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1C(=N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)