Products 13055-81-7
CAS 13055-81-7 is the registry number for 4,6-Diamino-1,3,5-triazine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-diamino-1,3,5-triazine-2-carboxylic acid (CAS 13055-81-7) is a chemical compound with the molecular formula C4H5N5O2 and a molecular weight of 155.12 g/mol. IUPAC name: 4,6-diamino-1,3,5-triazine-2-carboxylic acid. InChIKey: RIAHLLQDUDGKBF-UHFFFAOYSA-N.
| Molecular formula | C4H5N5O2 |
|---|---|
| Molecular weight | 155.12 g/mol |
| IUPAC name | 4,6-diamino-1,3,5-triazine-2-carboxylic acid |
| InChIKey | RIAHLLQDUDGKBF-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)N)N)C(=O)O |
Computed by PubChem (NCBI)