cas: 2589-12-0 — see every product listed under this CAS number, including other names
4,6-Dichloro-1H-imidazo[4,5-c]pyridine 97% (CAS 2589-12-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A249380-100mg |
| cas | 2589-12-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 1110.19 Pln | |
| Ambeed | 25g | 2673.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A249380 |
4,6-dichloro-1H-imidazo[4,5-c]pyridine (CAS 2589-12-0) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 4,6-dichloro-1H-imidazo[4,5-c]pyridine. InChIKey: FDXNZTUWNBRZDX-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 4,6-dichloro-1H-imidazo[4,5-c]pyridine |
| InChIKey | FDXNZTUWNBRZDX-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(N=C1Cl)Cl)N=CN2 |
Computed by PubChem (NCBI)