CAS 162548-73-4 appears in our catalog under these names: 4,6-Difluoro-2,3-dihydro-1H-inden-1-one, 98%, 98%, 4,6-Difluoroindan-1-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g.
4,6-difluoro-2,3-dihydroinden-1-one (CAS 162548-73-4) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 4,6-difluoro-2,3-dihydroinden-1-one. InChIKey: HBVVKRYLYPANAE-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 4,6-difluoro-2,3-dihydroinden-1-one |
| InChIKey | HBVVKRYLYPANAE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)F)F |
Computed by PubChem (NCBI)