CAS 117338-43-9 appears in our catalog under these names: 2,6-Difluorocinnamic aldehyde, 97%, 2,6–Difluorocinnamaldehyde, 2,6-Difluorocinnamaldehyde 97%, 2,6-Difluorocinnamic aldehyde, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
(E)-3-(2,6-difluorophenyl)prop-2-enal (CAS 117338-43-9) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: (E)-3-(2,6-difluorophenyl)prop-2-enal. InChIKey: ABQCTYYKKNJKPK-NSCUHMNNSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | (E)-3-(2,6-difluorophenyl)prop-2-enal |
| InChIKey | ABQCTYYKKNJKPK-NSCUHMNNSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C=C/C=O)F |
Computed by PubChem (NCBI)