CAS 405937-99-7 is the registry number for (2E)-3-(3,5-Difluorophenyl)prop-2-enal, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(E)-3-(3,5-difluorophenyl)prop-2-enal (CAS 405937-99-7) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: (E)-3-(3,5-difluorophenyl)prop-2-enal. InChIKey: VUJNIOGUAYENEA-OWOJBTEDSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | (E)-3-(3,5-difluorophenyl)prop-2-enal |
| InChIKey | VUJNIOGUAYENEA-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C=C1F)F)/C=C/C=O |
Computed by PubChem (NCBI)