CAS 628732-11-6 appears in our catalog under these names: 4,5-Difluoro-1-indanone, 98%, 4,5-Difluoro-2,3-dihydro-1H-inden-1-one 97%, 4,5-Difluoro-2,3-dihydro-1H-inden-1-one, 97%, 97%, 4,5-Difluoro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 25g.
4,5-difluoro-2,3-dihydroinden-1-one (CAS 628732-11-6) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 4,5-difluoro-2,3-dihydroinden-1-one. InChIKey: FHKJIIXGCLYMCN-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 4,5-difluoro-2,3-dihydroinden-1-one |
| InChIKey | FHKJIIXGCLYMCN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)F)F |
Computed by PubChem (NCBI)