cas: 90764-84-4 — see every product listed under this CAS number, including other names
4,6-Dimethoxypicolinic acid, 95%, 95% (CAS 90764-84-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FS7A-50mg |
| cas | 90764-84-4 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 458.00 Pln | |
| Chemat | 100mg | 659.60 Pln | |
| Chemat | 250mg | 1254.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,6-dimethoxypyridine-2-carboxylic acid (CAS 90764-84-4) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 4,6-dimethoxypyridine-2-carboxylic acid. InChIKey: OCOFPEDHFWODKY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 4,6-dimethoxypyridine-2-carboxylic acid |
| InChIKey | OCOFPEDHFWODKY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=C1)OC)C(=O)O |
Computed by PubChem (NCBI)